C9H7F3N2O5 — CID 107746041
2,2,2-trifluoroethyl N-(2-hydroxy-4-nitrophenyl)carbamate (PubChem CID 107746041) has the molecular formula C9H7F3N2O5 and a molecular weight of 280.16 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(2-hydroxy-4-nitrophenyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(2-hydroxy-4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 107746041 |
| Molecular Formula | C9H7F3N2O5 |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(2-hydroxy-4-nitrophenyl)carbamate |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1O)OCC(F)(F)F |
| InChI | InChI=1S/C9H7F3N2O5/c10-9(11,12)4-19-8(16)13-6-2-1-5(14(17)18)3-7(6)15/h1-3,15H,4H2,(H,13,16) |
| InChIKey | FXSMUHBBDKVAPK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|