C10H7F3N2O6 — CID 63110726
5-nitro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid (PubChem CID 63110726) has the molecular formula C10H7F3N2O6 and a molecular weight of 308.17 g/mol. Its IUPAC name is 5-nitro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid.
| Compound Name | 5-nitro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63110726 |
| Molecular Formula | C10H7F3N2O6 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 5-nitro-2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1C(=O)O)OCC(F)(F)F |
| InChI | InChI=1S/C10H7F3N2O6/c11-10(12,13)4-21-9(18)14-7-2-1-5(15(19)20)3-6(7)8(16)17/h1-3H,4H2,(H,14,18)(H,16,17) |
| InChIKey | QITSPHJBLQXKLB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|