C10H8F3NO4 — CID 61169225
2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid (PubChem CID 61169225) has the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid.
| Compound Name | 2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 61169225 |
| Molecular Formula | C10H8F3NO4 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxycarbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)OCC(F)(F)F |
| InChI | InChI=1S/C10H8F3NO4/c11-10(12,13)5-18-9(17)14-7-4-2-1-3-6(7)8(15)16/h1-4H,5H2,(H,14,17)(H,15,16) |
| InChIKey | MMDICXMOKAFDMC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |