C10H10F3NO2S — CID 65173338
2,2,2-trifluoroethyl N-(2-methylsulfanylphenyl)carbamate (PubChem CID 65173338) has the molecular formula C10H10F3NO2S and a molecular weight of 265.26 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(2-methylsulfanylphenyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(2-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 65173338 |
| Molecular Formula | C10H10F3NO2S |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(2-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccccc1NC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C10H10F3NO2S/c1-17-8-5-3-2-4-7(8)14-9(15)16-6-10(11,12)13/h2-5H,6H2,1H3,(H,14,15) |
| InChIKey | PEZDHXQVDLEUCL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |