C14H14F3N3OS — CID 96540208
(2S)-N-(2-methylsulfanylphenyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]propanamide (PubChem CID 96540208) has the molecular formula C14H14F3N3OS and a molecular weight of 329.35 g/mol. Its IUPAC name is (2S)-N-(2-methylsulfanylphenyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]propanamide.
| Compound Name | (2S)-N-(2-methylsulfanylphenyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 96540208 |
| Molecular Formula | C14H14F3N3OS |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (2S)-N-(2-methylsulfanylphenyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]propanamide |
| SMILES | CSc1ccccc1NC(=O)[C@H](C)n1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H14F3N3OS/c1-9(20-8-7-12(19-20)14(15,16)17)13(21)18-10-5-3-4-6-11(10)22-2/h3-9H,1-2H3,(H,18,21)/t9-/m0/s1 |
| InChIKey | SPFPCGCLQAXTHL-VIFPVBQESA-N |
| XLogP | 3.82 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |