C22H24F3N3O2S — CID 55627241
N-(2-methylsulfanylphenyl)-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]propanamide (PubChem CID 55627241) has the molecular formula C22H24F3N3O2S and a molecular weight of 451.51 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]propanamide.
| Compound Name | N-(2-methylsulfanylphenyl)-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 55627241 |
| Molecular Formula | C22H24F3N3O2S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-2-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]propanamide |
| SMILES | CSc1ccccc1NC(=O)C(C)N1CCN(C(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H24F3N3O2S/c1-15(20(29)26-18-9-5-6-10-19(18)31-2)27-11-13-28(14-12-27)21(30)16-7-3-4-8-17(16)22(23,24)25/h3-10,15H,11-14H2,1-2H3,(H,26,29) |
| InChIKey | QVVMOLDHTXWLLG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |