C18H25F3N4O2 — CID 55565664
2-[4-[2-(ethylamino)-2-oxoethyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 55565664) has the molecular formula C18H25F3N4O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-[4-[2-(ethylamino)-2-oxoethyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[4-[2-(ethylamino)-2-oxoethyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55565664 |
| Molecular Formula | C18H25F3N4O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-[4-[2-(ethylamino)-2-oxoethyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCNC(=O)CN1CCN(C(C)C(=O)Nc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H25F3N4O2/c1-3-22-16(26)12-24-8-10-25(11-9-24)13(2)17(27)23-15-7-5-4-6-14(15)18(19,20)21/h4-7,13H,3,8-12H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | NTGBNLOZERVFGR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |