C18H27F3N4O3S — CID 55498397
2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 55498397) has the molecular formula C18H27F3N4O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55498397 |
| Molecular Formula | C18H27F3N4O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(C)C(=O)Nc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H27F3N4O3S/c1-4-24(5-2)29(27,28)25-12-10-23(11-13-25)14(3)17(26)22-16-9-7-6-8-15(16)18(19,20)21/h6-9,14H,4-5,10-13H2,1-3H3,(H,22,26) |
| InChIKey | WZILLZRMMMZZRN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |