C20H19F6N3O3S — CID 2574388
(2S)-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 2574388) has the molecular formula C20H19F6N3O3S and a molecular weight of 495.45 g/mol. Its IUPAC name is (2S)-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 2574388 |
| Molecular Formula | C20H19F6N3O3S |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | (2S)-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(F)c(F)c1F)N1CCN(S(=O)(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H19F6N3O3S/c1-12(19(30)27-15-7-6-14(21)17(22)18(15)23)28-8-10-29(11-9-28)33(31,32)16-5-3-2-4-13(16)20(24,25)26/h2-7,12H,8-11H2,1H3,(H,27,30)/t12-/m0/s1 |
| InChIKey | WZTVWSURLIUYAY-LBPRGKRZSA-N |
| XLogP | 3.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|