C12H12F3NO4 — CID 65173497
methyl 2-phenyl-2-(2,2,2-trifluoroethoxycarbonylamino)acetate (PubChem CID 65173497) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is methyl 2-phenyl-2-(2,2,2-trifluoroethoxycarbonylamino)acetate.
| Compound Name | methyl 2-phenyl-2-(2,2,2-trifluoroethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 65173497 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | methyl 2-phenyl-2-(2,2,2-trifluoroethoxycarbonylamino)acetate |
| SMILES | COC(=O)C(NC(=O)OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H12F3NO4/c1-19-10(17)9(8-5-3-2-4-6-8)16-11(18)20-7-12(13,14)15/h2-6,9H,7H2,1H3,(H,16,18) |
| InChIKey | HSJIBAVHTIJHNE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |