C11H12F3NO2 — CID 60997518
methyl 2-phenyl-2-(2,2,2-trifluoroethylamino)acetate (PubChem CID 60997518) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is methyl 2-phenyl-2-(2,2,2-trifluoroethylamino)acetate.
| Compound Name | methyl 2-phenyl-2-(2,2,2-trifluoroethylamino)acetate |
|---|---|
| PubChem CID | 60997518 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | methyl 2-phenyl-2-(2,2,2-trifluoroethylamino)acetate |
| SMILES | COC(=O)C(NCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H12F3NO2/c1-17-10(16)9(15-7-11(12,13)14)8-5-3-2-4-6-8/h2-6,9,15H,7H2,1H3 |
| InChIKey | NHPHGLWPGCPZNB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |