C11H11BrF3NO2 — CID 54892807
methyl 2-(2-bromophenyl)-2-(2,2,2-trifluoroethylamino)acetate (PubChem CID 54892807) has the molecular formula C11H11BrF3NO2 and a molecular weight of 326.11 g/mol. Its IUPAC name is methyl 2-(2-bromophenyl)-2-(2,2,2-trifluoroethylamino)acetate.
| Compound Name | methyl 2-(2-bromophenyl)-2-(2,2,2-trifluoroethylamino)acetate |
|---|---|
| PubChem CID | 54892807 |
| Molecular Formula | C11H11BrF3NO2 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | methyl 2-(2-bromophenyl)-2-(2,2,2-trifluoroethylamino)acetate |
| SMILES | COC(=O)C(NCC(F)(F)F)c1ccccc1Br |
| InChI | InChI=1S/C11H11BrF3NO2/c1-18-10(17)9(16-6-11(13,14)15)7-4-2-3-5-8(7)12/h2-5,9,16H,6H2,1H3 |
| InChIKey | BDKLQHYKFZQFDK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |