C11H10Br2F3NO2 — CID 114077400
methyl 2-(3,4-dibromophenyl)-2-(2,2,2-trifluoroethylamino)acetate (PubChem CID 114077400) has the molecular formula C11H10Br2F3NO2 and a molecular weight of 405.01 g/mol. Its IUPAC name is methyl 2-(3,4-dibromophenyl)-2-(2,2,2-trifluoroethylamino)acetate.
| Compound Name | methyl 2-(3,4-dibromophenyl)-2-(2,2,2-trifluoroethylamino)acetate |
|---|---|
| PubChem CID | 114077400 |
| Molecular Formula | C11H10Br2F3NO2 |
| Molecular Weight | 405.01 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | methyl 2-(3,4-dibromophenyl)-2-(2,2,2-trifluoroethylamino)acetate |
| SMILES | COC(=O)C(NCC(F)(F)F)c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C11H10Br2F3NO2/c1-19-10(18)9(17-5-11(14,15)16)6-2-3-7(12)8(13)4-6/h2-4,9,17H,5H2,1H3 |
| InChIKey | KHQSDBNRIZXXQW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.01 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |