C13H15Br2NO2 — CID 114077398
methyl 2-(cyclopropylmethylamino)-2-(3,4-dibromophenyl)acetate (PubChem CID 114077398) has the molecular formula C13H15Br2NO2 and a molecular weight of 377.08 g/mol. Its IUPAC name is methyl 2-(cyclopropylmethylamino)-2-(3,4-dibromophenyl)acetate.
| Compound Name | methyl 2-(cyclopropylmethylamino)-2-(3,4-dibromophenyl)acetate |
|---|---|
| PubChem CID | 114077398 |
| Molecular Formula | C13H15Br2NO2 |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | methyl 2-(cyclopropylmethylamino)-2-(3,4-dibromophenyl)acetate |
| SMILES | COC(=O)C(NCC1CC1)c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C13H15Br2NO2/c1-18-13(17)12(16-7-8-2-3-8)9-4-5-10(14)11(15)6-9/h4-6,8,12,16H,2-3,7H2,1H3 |
| InChIKey | PKDKFKBKZQNLCY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |