C14H17BrFNO3 — CID 60993064
methyl 2-(3-bromo-4-fluorophenyl)-2-(oxolan-2-ylmethylamino)acetate (PubChem CID 60993064) has the molecular formula C14H17BrFNO3 and a molecular weight of 346.20 g/mol. Its IUPAC name is methyl 2-(3-bromo-4-fluorophenyl)-2-(oxolan-2-ylmethylamino)acetate.
| Compound Name | methyl 2-(3-bromo-4-fluorophenyl)-2-(oxolan-2-ylmethylamino)acetate |
|---|---|
| PubChem CID | 60993064 |
| Molecular Formula | C14H17BrFNO3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | methyl 2-(3-bromo-4-fluorophenyl)-2-(oxolan-2-ylmethylamino)acetate |
| SMILES | COC(=O)C(NCC1CCCO1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C14H17BrFNO3/c1-19-14(18)13(17-8-10-3-2-6-20-10)9-4-5-12(16)11(15)7-9/h4-5,7,10,13,17H,2-3,6,8H2,1H3 |
| InChIKey | KMVDYURMLVHONT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |