C14H19NO3 — CID 54894410
ethyl 2-(cyclopropylmethylamino)-2-(4-hydroxyphenyl)acetate (PubChem CID 54894410) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is ethyl 2-(cyclopropylmethylamino)-2-(4-hydroxyphenyl)acetate.
| Compound Name | ethyl 2-(cyclopropylmethylamino)-2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 54894410 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | ethyl 2-(cyclopropylmethylamino)-2-(4-hydroxyphenyl)acetate |
| SMILES | CCOC(=O)C(NCC1CC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H19NO3/c1-2-18-14(17)13(15-9-10-3-4-10)11-5-7-12(16)8-6-11/h5-8,10,13,15-16H,2-4,9H2,1H3 |
| InChIKey | UCPAGLQANWYHMI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |