C15H20ClNO3 — CID 104816560
ethyl 2-(2-chloro-6-methoxyphenyl)-2-(cyclopropylmethylamino)acetate (PubChem CID 104816560) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is ethyl 2-(2-chloro-6-methoxyphenyl)-2-(cyclopropylmethylamino)acetate.
| Compound Name | ethyl 2-(2-chloro-6-methoxyphenyl)-2-(cyclopropylmethylamino)acetate |
|---|---|
| PubChem CID | 104816560 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | ethyl 2-(2-chloro-6-methoxyphenyl)-2-(cyclopropylmethylamino)acetate |
| SMILES | CCOC(=O)C(NCC1CC1)c1c(Cl)cccc1OC |
| InChI | InChI=1S/C15H20ClNO3/c1-3-20-15(18)14(17-9-10-7-8-10)13-11(16)5-4-6-12(13)19-2/h4-6,10,14,17H,3,7-9H2,1-2H3 |
| InChIKey | HEOZKPPIJBNEOA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |