C15H23ClN2O3 — CID 104816553
ethyl 2-(2-chloro-6-methoxyphenyl)-2-[2-(dimethylamino)ethylamino]acetate (PubChem CID 104816553) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is ethyl 2-(2-chloro-6-methoxyphenyl)-2-[2-(dimethylamino)ethylamino]acetate.
| Compound Name | ethyl 2-(2-chloro-6-methoxyphenyl)-2-[2-(dimethylamino)ethylamino]acetate |
|---|---|
| PubChem CID | 104816553 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | ethyl 2-(2-chloro-6-methoxyphenyl)-2-[2-(dimethylamino)ethylamino]acetate |
| SMILES | CCOC(=O)C(NCCN(C)C)c1c(Cl)cccc1OC |
| InChI | InChI=1S/C15H23ClN2O3/c1-5-21-15(19)14(17-9-10-18(2)3)13-11(16)7-6-8-12(13)20-4/h6-8,14,17H,5,9-10H2,1-4H3 |
| InChIKey | OZNRKCDBZKGMQQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |