C12H20N2O2S — CID 61347720
ethyl 2-[2-(dimethylamino)ethylamino]-2-thiophen-2-ylacetate (PubChem CID 61347720) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is ethyl 2-[2-(dimethylamino)ethylamino]-2-thiophen-2-ylacetate.
| Compound Name | ethyl 2-[2-(dimethylamino)ethylamino]-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 61347720 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | ethyl 2-[2-(dimethylamino)ethylamino]-2-thiophen-2-ylacetate |
| SMILES | CCOC(=O)C(NCCN(C)C)c1cccs1 |
| InChI | InChI=1S/C12H20N2O2S/c1-4-16-12(15)11(10-6-5-9-17-10)13-7-8-14(2)3/h5-6,9,11,13H,4,7-8H2,1-3H3 |
| InChIKey | VFPPIDCUMJQJJF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |