C14H16BrNO2S2 — CID 102840934
ethyl 2-(4-bromo-5-methylthiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetate (PubChem CID 102840934) has the molecular formula C14H16BrNO2S2 and a molecular weight of 374.33 g/mol. Its IUPAC name is ethyl 2-(4-bromo-5-methylthiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetate.
| Compound Name | ethyl 2-(4-bromo-5-methylthiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetate |
|---|---|
| PubChem CID | 102840934 |
| Molecular Formula | C14H16BrNO2S2 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | ethyl 2-(4-bromo-5-methylthiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetate |
| SMILES | CCOC(=O)C(NCc1cccs1)c1cc(Br)c(C)s1 |
| InChI | InChI=1S/C14H16BrNO2S2/c1-3-18-14(17)13(12-7-11(15)9(2)20-12)16-8-10-5-4-6-19-10/h4-7,13,16H,3,8H2,1-2H3 |
| InChIKey | QQWJMCNAKOCTAY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |