C13H15NO2S2 — CID 54895068
ethyl 2-thiophen-3-yl-2-(thiophen-2-ylmethylamino)acetate (PubChem CID 54895068) has the molecular formula C13H15NO2S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is ethyl 2-thiophen-3-yl-2-(thiophen-2-ylmethylamino)acetate.
| Compound Name | ethyl 2-thiophen-3-yl-2-(thiophen-2-ylmethylamino)acetate |
|---|---|
| PubChem CID | 54895068 |
| Molecular Formula | C13H15NO2S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | ethyl 2-thiophen-3-yl-2-(thiophen-2-ylmethylamino)acetate |
| SMILES | CCOC(=O)C(NCc1cccs1)c1ccsc1 |
| InChI | InChI=1S/C13H15NO2S2/c1-2-16-13(15)12(10-5-7-17-9-10)14-8-11-4-3-6-18-11/h3-7,9,12,14H,2,8H2,1H3 |
| InChIKey | CFVQKLXPNSSVJA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |