C12H12BrNO2S2 — CID 61345410
methyl 2-(4-bromothiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetate (PubChem CID 61345410) has the molecular formula C12H12BrNO2S2 and a molecular weight of 346.27 g/mol. Its IUPAC name is methyl 2-(4-bromothiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetate.
| Compound Name | methyl 2-(4-bromothiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetate |
|---|---|
| PubChem CID | 61345410 |
| Molecular Formula | C12H12BrNO2S2 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | methyl 2-(4-bromothiophen-2-yl)-2-(thiophen-2-ylmethylamino)acetate |
| SMILES | COC(=O)C(NCc1cccs1)c1cc(Br)cs1 |
| InChI | InChI=1S/C12H12BrNO2S2/c1-16-12(15)11(10-5-8(13)7-18-10)14-6-9-3-2-4-17-9/h2-5,7,11,14H,6H2,1H3 |
| InChIKey | QKHZVCMFPIBXOA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |