C15H15ClFNO2S — CID 114453685
ethyl 2-(3-chloro-5-fluorophenyl)-2-(thiophen-2-ylmethylamino)acetate (PubChem CID 114453685) has the molecular formula C15H15ClFNO2S and a molecular weight of 327.81 g/mol. Its IUPAC name is ethyl 2-(3-chloro-5-fluorophenyl)-2-(thiophen-2-ylmethylamino)acetate.
| Compound Name | ethyl 2-(3-chloro-5-fluorophenyl)-2-(thiophen-2-ylmethylamino)acetate |
|---|---|
| PubChem CID | 114453685 |
| Molecular Formula | C15H15ClFNO2S |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | ethyl 2-(3-chloro-5-fluorophenyl)-2-(thiophen-2-ylmethylamino)acetate |
| SMILES | CCOC(=O)C(NCc1cccs1)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C15H15ClFNO2S/c1-2-20-15(19)14(18-9-13-4-3-5-21-13)10-6-11(16)8-12(17)7-10/h3-8,14,18H,2,9H2,1H3 |
| InChIKey | WALVPZOWFRHSGD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |