C16H19Cl2NO2S — CID 141274258
ethyl (2S)-2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetate;hydrochloride (PubChem CID 141274258) has the molecular formula C16H19Cl2NO2S and a molecular weight of 360.31 g/mol. Its IUPAC name is ethyl (2S)-2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetate;hydrochloride.
| Compound Name | ethyl (2S)-2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetate;hydrochloride |
|---|---|
| PubChem CID | 141274258 |
| Molecular Formula | C16H19Cl2NO2S |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | ethyl (2S)-2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetate;hydrochloride |
| SMILES | CCOC(=O)[C@@H](NCCc1cccs1)c1ccccc1Cl.Cl |
| InChI | InChI=1S/C16H18ClNO2S.ClH/c1-2-20-16(19)15(13-7-3-4-8-14(13)17)18-10-9-12-6-5-11-21-12;/h3-8,11,15,18H,2,9-10H2,1H3;1H/t15-;/m0./s1 |
| InChIKey | JMUDQKYQPXHARY-RSAXXLAASA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |