C14H14ClNO2S2 — CID 163919902
[(2-chlorophenyl)-(2-thiophen-2-ylethylamino)methyl]sulfanylformic acid (PubChem CID 163919902) has the molecular formula C14H14ClNO2S2 and a molecular weight of 327.86 g/mol. Its IUPAC name is [(2-chlorophenyl)-(2-thiophen-2-ylethylamino)methyl]sulfanylformic acid.
| Compound Name | [(2-chlorophenyl)-(2-thiophen-2-ylethylamino)methyl]sulfanylformic acid |
|---|---|
| PubChem CID | 163919902 |
| Molecular Formula | C14H14ClNO2S2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | [(2-chlorophenyl)-(2-thiophen-2-ylethylamino)methyl]sulfanylformic acid |
| SMILES | O=C(O)SC(NCCc1cccs1)c1ccccc1Cl |
| InChI | InChI=1S/C14H14ClNO2S2/c15-12-6-2-1-5-11(12)13(20-14(17)18)16-8-7-10-4-3-9-19-10/h1-6,9,13,16H,7-8H2,(H,17,18) |
| InChIKey | QZNMLKOYTBFUDI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|