C16H19ClN2O2S — CID 50953100
3-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 50953100) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 50953100 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | O=C(CCNCC(O)c1ccccc1Cl)NCc1cccs1 |
| InChI | InChI=1S/C16H19ClN2O2S/c17-14-6-2-1-5-13(14)15(20)11-18-8-7-16(21)19-10-12-4-3-9-22-12/h1-6,9,15,18,20H,7-8,10-11H2,(H,19,21) |
| InChIKey | IGKUOCFOIHMFTM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|