C15H21ClN2O3 — CID 111450926
N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylpentanediamide (PubChem CID 111450926) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylpentanediamide.
| Compound Name | N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylpentanediamide |
|---|---|
| PubChem CID | 111450926 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N'-[2-(2-chlorophenyl)-2-hydroxyethyl]-N-ethylpentanediamide |
| SMILES | CCNC(=O)CCCC(=O)NCC(O)c1ccccc1Cl |
| InChI | InChI=1S/C15H21ClN2O3/c1-2-17-14(20)8-5-9-15(21)18-10-13(19)11-6-3-4-7-12(11)16/h3-4,6-7,13,19H,2,5,8-10H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | KNBPPBQWUDMFGA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |