C10H11ClN2O4 — CID 23292408
carbamoyl N-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamate (PubChem CID 23292408) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is carbamoyl N-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamate.
| Compound Name | carbamoyl N-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 23292408 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | carbamoyl N-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamate |
| SMILES | NC(=O)OC(=O)NCC(O)c1ccccc1Cl |
| InChI | InChI=1S/C10H11ClN2O4/c11-7-4-2-1-3-6(7)8(14)5-13-10(16)17-9(12)15/h1-4,8,14H,5H2,(H2,12,15)(H,13,16) |
| InChIKey | VTTZXDUGXMSSTA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|