C17H28ClN3O2 — CID 111453913
1-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-[2-[di(propan-2-yl)amino]ethyl]urea (PubChem CID 111453913) has the molecular formula C17H28ClN3O2 and a molecular weight of 341.88 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-[2-[di(propan-2-yl)amino]ethyl]urea.
| Compound Name | 1-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-[2-[di(propan-2-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 111453913 |
| Molecular Formula | C17H28ClN3O2 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[2-(2-chlorophenyl)-2-hydroxyethyl]-3-[2-[di(propan-2-yl)amino]ethyl]urea |
| SMILES | CC(C)N(CCNC(=O)NCC(O)c1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C17H28ClN3O2/c1-12(2)21(13(3)4)10-9-19-17(23)20-11-16(22)14-7-5-6-8-15(14)18/h5-8,12-13,16,22H,9-11H2,1-4H3,(H2,19,20,23) |
| InChIKey | WNDCTMHCJHULSY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |