C15H22Cl3N3O — CID 3793691
1-[2-[di(propan-2-yl)amino]ethyl]-3-(2,4,5-trichlorophenyl)urea (PubChem CID 3793691) has the molecular formula C15H22Cl3N3O and a molecular weight of 366.72 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-3-(2,4,5-trichlorophenyl)urea.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-(2,4,5-trichlorophenyl)urea |
|---|---|
| PubChem CID | 3793691 |
| Molecular Formula | C15H22Cl3N3O |
| Molecular Weight | 366.72 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-(2,4,5-trichlorophenyl)urea |
| SMILES | CC(C)N(CCNC(=O)Nc1cc(Cl)c(Cl)cc1Cl)C(C)C |
| InChI | InChI=1S/C15H22Cl3N3O/c1-9(2)21(10(3)4)6-5-19-15(22)20-14-8-12(17)11(16)7-13(14)18/h7-10H,5-6H2,1-4H3,(H2,19,20,22) |
| InChIKey | MJTHNCDIZWXDFO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.72 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|