C11H25N3O2 — CID 110894307
1-[2-[di(propan-2-yl)amino]ethyl]-3-(2-hydroxyethyl)urea (PubChem CID 110894307) has the molecular formula C11H25N3O2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110894307 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-(2-hydroxyethyl)urea |
| SMILES | CC(C)N(CCNC(=O)NCCO)C(C)C |
| InChI | InChI=1S/C11H25N3O2/c1-9(2)14(10(3)4)7-5-12-11(16)13-6-8-15/h9-10,15H,5-8H2,1-4H3,(H2,12,13,16) |
| InChIKey | XDTWFQLWRZGPLP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |