C13H28N2OS — CID 107019789
N-[2-[di(propan-2-yl)amino]ethyl]-3-methyl-2-sulfanylbutanamide (PubChem CID 107019789) has the molecular formula C13H28N2OS and a molecular weight of 260.45 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-3-methyl-2-sulfanylbutanamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-3-methyl-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107019789 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-3-methyl-2-sulfanylbutanamide |
| SMILES | CC(C)C(S)C(=O)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C13H28N2OS/c1-9(2)12(17)13(16)14-7-8-15(10(3)4)11(5)6/h9-12,17H,7-8H2,1-6H3,(H,14,16) |
| InChIKey | XKIZCFUMHITAFM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|