C9H20N2O3S2 — CID 106340115
N-[2-(ethylsulfamoyl)ethyl]-3-methyl-2-sulfanylbutanamide (PubChem CID 106340115) has the molecular formula C9H20N2O3S2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N-[2-(ethylsulfamoyl)ethyl]-3-methyl-2-sulfanylbutanamide.
| Compound Name | N-[2-(ethylsulfamoyl)ethyl]-3-methyl-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 106340115 |
| Molecular Formula | C9H20N2O3S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-[2-(ethylsulfamoyl)ethyl]-3-methyl-2-sulfanylbutanamide |
| SMILES | CCNS(=O)(=O)CCNC(=O)C(S)C(C)C |
| InChI | InChI=1S/C9H20N2O3S2/c1-4-11-16(13,14)6-5-10-9(12)8(15)7(2)3/h7-8,11,15H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | FZGSJMUHOUEOQD-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|