C8H17NO3S2 — CID 107023632
3-methyl-N-(2-methylsulfonylethyl)-2-sulfanylbutanamide (PubChem CID 107023632) has the molecular formula C8H17NO3S2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-methyl-N-(2-methylsulfonylethyl)-2-sulfanylbutanamide.
| Compound Name | 3-methyl-N-(2-methylsulfonylethyl)-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107023632 |
| Molecular Formula | C8H17NO3S2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-methyl-N-(2-methylsulfonylethyl)-2-sulfanylbutanamide |
| SMILES | CC(C)C(S)C(=O)NCCS(C)(=O)=O |
| InChI | InChI=1S/C8H17NO3S2/c1-6(2)7(13)8(10)9-4-5-14(3,11)12/h6-7,13H,4-5H2,1-3H3,(H,9,10) |
| InChIKey | QAHHTAWFPVVDDE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|