C9H18N2O2S — CID 107023481
N-(4-amino-4-oxobutyl)-3-methyl-2-sulfanylbutanamide (PubChem CID 107023481) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-3-methyl-2-sulfanylbutanamide.
| Compound Name | N-(4-amino-4-oxobutyl)-3-methyl-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107023481 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-3-methyl-2-sulfanylbutanamide |
| SMILES | CC(C)C(S)C(=O)NCCCC(N)=O |
| InChI | InChI=1S/C9H18N2O2S/c1-6(2)8(14)9(13)11-5-3-4-7(10)12/h6,8,14H,3-5H2,1-2H3,(H2,10,12)(H,11,13) |
| InChIKey | XIQKXBWEUUHTKZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|