C6H10F2N2O2 — CID 103515414
4-[(2,2-difluoroacetyl)amino]butanamide (PubChem CID 103515414) has the molecular formula C6H10F2N2O2 and a molecular weight of 180.15 g/mol. Its IUPAC name is 4-[(2,2-difluoroacetyl)amino]butanamide.
| Compound Name | 4-[(2,2-difluoroacetyl)amino]butanamide |
|---|---|
| PubChem CID | 103515414 |
| Molecular Formula | C6H10F2N2O2 |
| Molecular Weight | 180.15 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 4-[(2,2-difluoroacetyl)amino]butanamide |
| SMILES | NC(=O)CCCNC(=O)C(F)F |
| InChI | InChI=1S/C6H10F2N2O2/c7-5(8)6(12)10-3-1-2-4(9)11/h5H,1-3H2,(H2,9,11)(H,10,12) |
| InChIKey | SSTSRYYKPADHPI-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.15 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|