C8H16N4O3 — CID 76926545
3-amino-N-(4-amino-4-oxobutyl)-3-hydroxyimino-2-methylpropanamide (PubChem CID 76926545) has the molecular formula C8H16N4O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 3-amino-N-(4-amino-4-oxobutyl)-3-hydroxyimino-2-methylpropanamide.
| Compound Name | 3-amino-N-(4-amino-4-oxobutyl)-3-hydroxyimino-2-methylpropanamide |
|---|---|
| PubChem CID | 76926545 |
| Molecular Formula | C8H16N4O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 3-amino-N-(4-amino-4-oxobutyl)-3-hydroxyimino-2-methylpropanamide |
| SMILES | CC(C(=O)NCCCC(N)=O)C(N)=NO |
| InChI | InChI=1S/C8H16N4O3/c1-5(7(10)12-15)8(14)11-4-2-3-6(9)13/h5,15H,2-4H2,1H3,(H2,9,13)(H2,10,12)(H,11,14) |
| InChIKey | BPQINNFKSJHQPZ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|