C6H14N4O2 — CID 77029016
3-[(1-amino-1-hydroxyiminopropan-2-yl)amino]propanamide (PubChem CID 77029016) has the molecular formula C6H14N4O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-[(1-amino-1-hydroxyiminopropan-2-yl)amino]propanamide.
| Compound Name | 3-[(1-amino-1-hydroxyiminopropan-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 77029016 |
| Molecular Formula | C6H14N4O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 3-[(1-amino-1-hydroxyiminopropan-2-yl)amino]propanamide |
| SMILES | CC(NCCC(N)=O)C(N)=NO |
| InChI | InChI=1S/C6H14N4O2/c1-4(6(8)10-12)9-3-2-5(7)11/h4,9,12H,2-3H2,1H3,(H2,7,11)(H2,8,10) |
| InChIKey | XDCXWLWPBWVWOO-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|