C9H22N4O — CID 77026359
2-[2-(diethylamino)ethylamino]-N'-hydroxypropanimidamide (PubChem CID 77026359) has the molecular formula C9H22N4O and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-N'-hydroxypropanimidamide.
| Compound Name | 2-[2-(diethylamino)ethylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77026359 |
| Molecular Formula | C9H22N4O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.18 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-N'-hydroxypropanimidamide |
| SMILES | CCN(CC)CCNC(C)C(N)=NO |
| InChI | InChI=1S/C9H22N4O/c1-4-13(5-2)7-6-11-8(3)9(10)12-14/h8,11,14H,4-7H2,1-3H3,(H2,10,12) |
| InChIKey | PUOTUONIMFMXJJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|