C12H25NOS — CID 107034108
3-methyl-2-sulfanyl-N-(2,3,3-trimethylbutyl)butanamide (PubChem CID 107034108) has the molecular formula C12H25NOS and a molecular weight of 231.40 g/mol. Its IUPAC name is 3-methyl-2-sulfanyl-N-(2,3,3-trimethylbutyl)butanamide.
| Compound Name | 3-methyl-2-sulfanyl-N-(2,3,3-trimethylbutyl)butanamide |
|---|---|
| PubChem CID | 107034108 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3-methyl-2-sulfanyl-N-(2,3,3-trimethylbutyl)butanamide |
| SMILES | CC(C)C(S)C(=O)NCC(C)C(C)(C)C |
| InChI | InChI=1S/C12H25NOS/c1-8(2)10(15)11(14)13-7-9(3)12(4,5)6/h8-10,15H,7H2,1-6H3,(H,13,14) |
| InChIKey | GZLBFHKOQDQAEF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|