C12H25NO2S — CID 106149644
N-(5-hydroxy-2,2-dimethylpentyl)-3-methyl-2-sulfanylbutanamide (PubChem CID 106149644) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is N-(5-hydroxy-2,2-dimethylpentyl)-3-methyl-2-sulfanylbutanamide.
| Compound Name | N-(5-hydroxy-2,2-dimethylpentyl)-3-methyl-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 106149644 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-(5-hydroxy-2,2-dimethylpentyl)-3-methyl-2-sulfanylbutanamide |
| SMILES | CC(C)C(S)C(=O)NCC(C)(C)CCCO |
| InChI | InChI=1S/C12H25NO2S/c1-9(2)10(16)11(15)13-8-12(3,4)6-5-7-14/h9-10,14,16H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | PQMKVIVWDBTNME-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|