C13H28N2O3 — CID 106148113
2-amino-N-(5-hydroxy-2,2-dimethylpentyl)-5-methoxypentanamide (PubChem CID 106148113) has the molecular formula C13H28N2O3 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-amino-N-(5-hydroxy-2,2-dimethylpentyl)-5-methoxypentanamide.
| Compound Name | 2-amino-N-(5-hydroxy-2,2-dimethylpentyl)-5-methoxypentanamide |
|---|---|
| PubChem CID | 106148113 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 2-amino-N-(5-hydroxy-2,2-dimethylpentyl)-5-methoxypentanamide |
| SMILES | COCCCC(N)C(=O)NCC(C)(C)CCCO |
| InChI | InChI=1S/C13H28N2O3/c1-13(2,7-5-8-16)10-15-12(17)11(14)6-4-9-18-3/h11,16H,4-10,14H2,1-3H3,(H,15,17) |
| InChIKey | BICYQLUKKUTGHS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|