C10H21NO3S2 — CID 107032215
3-methyl-N-(2-methyl-2-methylsulfonylpropyl)-2-sulfanylbutanamide (PubChem CID 107032215) has the molecular formula C10H21NO3S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is 3-methyl-N-(2-methyl-2-methylsulfonylpropyl)-2-sulfanylbutanamide.
| Compound Name | 3-methyl-N-(2-methyl-2-methylsulfonylpropyl)-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107032215 |
| Molecular Formula | C10H21NO3S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-methyl-N-(2-methyl-2-methylsulfonylpropyl)-2-sulfanylbutanamide |
| SMILES | CC(C)C(S)C(=O)NCC(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C10H21NO3S2/c1-7(2)8(15)9(12)11-6-10(3,4)16(5,13)14/h7-8,15H,6H2,1-5H3,(H,11,12) |
| InChIKey | COKDGOSPNXZWRW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|