C8H18N2O3S2 — CID 107030203
N-[2-(methanesulfonamido)-2-methylpropyl]-2-sulfanylpropanamide (PubChem CID 107030203) has the molecular formula C8H18N2O3S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)-2-methylpropyl]-2-sulfanylpropanamide.
| Compound Name | N-[2-(methanesulfonamido)-2-methylpropyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107030203 |
| Molecular Formula | C8H18N2O3S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N-[2-(methanesulfonamido)-2-methylpropyl]-2-sulfanylpropanamide |
| SMILES | CC(S)C(=O)NCC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C8H18N2O3S2/c1-6(14)7(11)9-5-8(2,3)10-15(4,12)13/h6,10,14H,5H2,1-4H3,(H,9,11) |
| InChIKey | LUUQUVVSBGUFOL-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|