C8H20N2O3S — CID 106932132
N-[1-[[(2R)-2-hydroxypropyl]amino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 106932132) has the molecular formula C8H20N2O3S and a molecular weight of 224.33 g/mol. Its IUPAC name is N-[1-[[(2R)-2-hydroxypropyl]amino]-2-methylpropan-2-yl]methanesulfonamide.
| Compound Name | N-[1-[[(2R)-2-hydroxypropyl]amino]-2-methylpropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 106932132 |
| Molecular Formula | C8H20N2O3S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-[1-[[(2R)-2-hydroxypropyl]amino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | C[C@@H](O)CNCC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C8H20N2O3S/c1-7(11)5-9-6-8(2,3)10-14(4,12)13/h7,9-11H,5-6H2,1-4H3/t7-/m1/s1 |
| InChIKey | LGDRRHLFBYFLRK-SSDOTTSWSA-N |
| XLogP | -0.72 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |