C12H27N3O3S — CID 63858980
N-[1-[(2-hydroxy-3-pyrrolidin-1-ylpropyl)amino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 63858980) has the molecular formula C12H27N3O3S and a molecular weight of 293.43 g/mol. Its IUPAC name is N-[1-[(2-hydroxy-3-pyrrolidin-1-ylpropyl)amino]-2-methylpropan-2-yl]methanesulfonamide.
| Compound Name | N-[1-[(2-hydroxy-3-pyrrolidin-1-ylpropyl)amino]-2-methylpropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 63858980 |
| Molecular Formula | C12H27N3O3S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-[1-[(2-hydroxy-3-pyrrolidin-1-ylpropyl)amino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | CC(C)(CNCC(O)CN1CCCC1)NS(C)(=O)=O |
| InChI | InChI=1S/C12H27N3O3S/c1-12(2,14-19(3,17)18)10-13-8-11(16)9-15-6-4-5-7-15/h11,13-14,16H,4-10H2,1-3H3 |
| InChIKey | HKPHSZXLNOJMJN-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |