C10H22N2O5S — CID 113436539
methyl 2-hydroxy-3-[[2-(methanesulfonamido)-2-methylpropyl]amino]-2-methylpropanoate (PubChem CID 113436539) has the molecular formula C10H22N2O5S and a molecular weight of 282.36 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[2-(methanesulfonamido)-2-methylpropyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-hydroxy-3-[[2-(methanesulfonamido)-2-methylpropyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 113436539 |
| Molecular Formula | C10H22N2O5S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | methyl 2-hydroxy-3-[[2-(methanesulfonamido)-2-methylpropyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CNCC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C10H22N2O5S/c1-9(2,12-18(5,15)16)6-11-7-10(3,14)8(13)17-4/h11-12,14H,6-7H2,1-5H3 |
| InChIKey | KILKAEAHELRJHP-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |