C11H22N2O3S2 — CID 79550769
2-carbamothioyl-3-methyl-N-(2-methyl-2-methylsulfonylpropyl)butanamide (PubChem CID 79550769) has the molecular formula C11H22N2O3S2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-carbamothioyl-3-methyl-N-(2-methyl-2-methylsulfonylpropyl)butanamide.
| Compound Name | 2-carbamothioyl-3-methyl-N-(2-methyl-2-methylsulfonylpropyl)butanamide |
|---|---|
| PubChem CID | 79550769 |
| Molecular Formula | C11H22N2O3S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-carbamothioyl-3-methyl-N-(2-methyl-2-methylsulfonylpropyl)butanamide |
| SMILES | CC(C)C(C(=O)NCC(C)(C)S(C)(=O)=O)C(N)=S |
| InChI | InChI=1S/C11H22N2O3S2/c1-7(2)8(9(12)17)10(14)13-6-11(3,4)18(5,15)16/h7-8H,6H2,1-5H3,(H2,12,17)(H,13,14) |
| InChIKey | ULNWCZOVUDBBMF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|