C11H19F3N2OS — CID 115519819
2-carbamothioyl-3-methyl-N-(5,5,5-trifluoropentyl)butanamide (PubChem CID 115519819) has the molecular formula C11H19F3N2OS and a molecular weight of 284.35 g/mol. Its IUPAC name is 2-carbamothioyl-3-methyl-N-(5,5,5-trifluoropentyl)butanamide.
| Compound Name | 2-carbamothioyl-3-methyl-N-(5,5,5-trifluoropentyl)butanamide |
|---|---|
| PubChem CID | 115519819 |
| Molecular Formula | C11H19F3N2OS |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-carbamothioyl-3-methyl-N-(5,5,5-trifluoropentyl)butanamide |
| SMILES | CC(C)C(C(=O)NCCCCC(F)(F)F)C(N)=S |
| InChI | InChI=1S/C11H19F3N2OS/c1-7(2)8(9(15)18)10(17)16-6-4-3-5-11(12,13)14/h7-8H,3-6H2,1-2H3,(H2,15,18)(H,16,17) |
| InChIKey | ODSZONMESHXDIH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|