C8H14F2N2OS — CID 115407171
2-carbamothioyl-N-(2,2-difluoroethyl)-3-methylbutanamide (PubChem CID 115407171) has the molecular formula C8H14F2N2OS and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-carbamothioyl-N-(2,2-difluoroethyl)-3-methylbutanamide.
| Compound Name | 2-carbamothioyl-N-(2,2-difluoroethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 115407171 |
| Molecular Formula | C8H14F2N2OS |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-carbamothioyl-N-(2,2-difluoroethyl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)NCC(F)F)C(N)=S |
| InChI | InChI=1S/C8H14F2N2OS/c1-4(2)6(7(11)14)8(13)12-3-5(9)10/h4-6H,3H2,1-2H3,(H2,11,14)(H,12,13) |
| InChIKey | OVQJYPWNYNTTCD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|